C27H27F3N6O3 — CID 2964172
5-(3,4-dimethoxyphenyl)-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2964172) has the molecular formula C27H27F3N6O3 and a molecular weight of 540.55 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2964172 |
| Molecular Formula | C27H27F3N6O3 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc(C2CC(C(F)(F)F)n3nc(C(=O)Nc4ccn(Cc5ccccc5C)n4)cc3N2)cc1OC |
| InChI | InChI=1S/C27H27F3N6O3/c1-16-6-4-5-7-18(16)15-35-11-10-24(34-35)32-26(37)20-14-25-31-19(13-23(27(28,29)30)36(25)33-20)17-8-9-21(38-2)22(12-17)39-3/h4-12,14,19,23,31H,13,15H2,1-3H3,(H,32,34,37) |
| InChIKey | UAWINCLMVXYZPA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |