C23H20N2O3S — CID 2964757
4-(benzenesulfonyl)-2-phenyl-N-(1-phenylethyl)-1,3-oxazol-5-amine (PubChem CID 2964757) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-phenyl-N-(1-phenylethyl)-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-2-phenyl-N-(1-phenylethyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 2964757 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-(benzenesulfonyl)-2-phenyl-N-(1-phenylethyl)-1,3-oxazol-5-amine |
| SMILES | CC(Nc1oc(-c2ccccc2)nc1S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-17(18-11-5-2-6-12-18)24-22-23(29(26,27)20-15-9-4-10-16-20)25-21(28-22)19-13-7-3-8-14-19/h2-17,24H,1H3 |
| InChIKey | KEPPEJXJGULBPD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |