C17H15NO3S2 — CID 751371
4-(benzenesulfonyl)-5-ethylsulfanyl-2-phenyl-1,3-oxazole (PubChem CID 751371) has the molecular formula C17H15NO3S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-ethylsulfanyl-2-phenyl-1,3-oxazole.
| Compound Name | 4-(benzenesulfonyl)-5-ethylsulfanyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 751371 |
| Molecular Formula | C17H15NO3S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-(benzenesulfonyl)-5-ethylsulfanyl-2-phenyl-1,3-oxazole |
| SMILES | CCSc1oc(-c2ccccc2)nc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO3S2/c1-2-22-17-16(23(19,20)14-11-7-4-8-12-14)18-15(21-17)13-9-5-3-6-10-13/h3-12H,2H2,1H3 |
| InChIKey | OLQJVXFSFSZYOU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |