C12H9N3O2 — CID 2972009
3-methyl-7-nitropyrido[1,2-a]benzimidazole (PubChem CID 2972009) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-methyl-7-nitropyrido[1,2-a]benzimidazole.
| Compound Name | 3-methyl-7-nitropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 2972009 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-methyl-7-nitropyrido[1,2-a]benzimidazole |
| SMILES | Cc1ccn2c(c1)nc1cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C12H9N3O2/c1-8-4-5-14-11-3-2-9(15(16)17)7-10(11)13-12(14)6-8/h2-7H,1H3 |
| InChIKey | ABTUGHIIUXNNEF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|