C23H23F3N4O3S — CID 2972441
ethyl 4,5-dimethyl-2-[[5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 2972441) has the molecular formula C23H23F3N4O3S and a molecular weight of 492.52 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[[5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[[5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2972441 |
| Molecular Formula | C23H23F3N4O3S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[[5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc3n(n2)C(C(F)(F)F)CC(c2ccccc2)N3)sc(C)c1C |
| InChI | InChI=1S/C23H23F3N4O3S/c1-4-33-22(32)19-12(2)13(3)34-21(19)28-20(31)16-11-18-27-15(14-8-6-5-7-9-14)10-17(23(24,25)26)30(18)29-16/h5-9,11,15,17,27H,4,10H2,1-3H3,(H,28,31) |
| InChIKey | IOTFPBCQYBBANL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |