C28H30N2O5 — CID 2981019
propan-2-yl 4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoyl]amino]benzoate (PubChem CID 2981019) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is propan-2-yl 4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 2981019 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | propan-2-yl 4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)C(Cc2ccccc2)N2C(=O)C3C4CCC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C28H30N2O5/c1-16(2)35-28(34)18-10-12-21(13-11-18)29-25(31)22(14-17-6-4-3-5-7-17)30-26(32)23-19-8-9-20(15-19)24(23)27(30)33/h3-7,10-13,16,19-20,22-24H,8-9,14-15H2,1-2H3,(H,29,31) |
| InChIKey | DNIALPQMOMJZMM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|