C19H19BrN2O5S — CID 2981655
N-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 2981655) has the molecular formula C19H19BrN2O5S and a molecular weight of 467.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 2981655 |
| Molecular Formula | C19H19BrN2O5S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H19BrN2O5S/c20-14-3-6-16(7-4-14)28(24,25)22-9-1-2-13(11-22)19(23)21-15-5-8-17-18(10-15)27-12-26-17/h3-8,10,13H,1-2,9,11-12H2,(H,21,23) |
| InChIKey | MDKQSLYSOFTORN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |