C19H24FN3O4S — CID 2994459
N-(5-tert-butyl-1,2-oxazol-3-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2994459) has the molecular formula C19H24FN3O4S and a molecular weight of 409.48 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2994459 |
| Molecular Formula | C19H24FN3O4S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)no1 |
| InChI | InChI=1S/C19H24FN3O4S/c1-19(2,3)16-12-17(22-27-16)21-18(24)13-7-8-14(20)15(11-13)28(25,26)23-9-5-4-6-10-23/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,21,22,24) |
| InChIKey | CGHUTTPUAUNLME-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |