C10H7Cl2N3OS2 — CID 2994551
3,4-dichloro-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 2994551) has the molecular formula C10H7Cl2N3OS2 and a molecular weight of 320.23 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 2994551 |
| Molecular Formula | C10H7Cl2N3OS2 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 3,4-dichloro-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | CSc1nsc(NC(=O)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C10H7Cl2N3OS2/c1-17-10-14-9(18-15-10)13-8(16)5-2-3-6(11)7(12)4-5/h2-4H,1H3,(H,13,14,15,16) |
| InChIKey | XTGNIPKQFWWVEE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |