C13H13N5O4S2 — CID 4842437
N-[3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 4842437) has the molecular formula C13H13N5O4S2 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4842437 |
| Molecular Formula | C13H13N5O4S2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-[3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | CSc1nsc(NC(=O)CCNC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C13H13N5O4S2/c1-23-13-16-12(24-17-13)15-10(19)6-7-14-11(20)8-2-4-9(5-3-8)18(21)22/h2-5H,6-7H2,1H3,(H,14,20)(H,15,16,17,19) |
| InChIKey | FWJBQLVDARFJJY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|