C19H20FN5O2 — CID 2997082
1-(4-fluorophenyl)-3-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]pyrrolidine-2,5-dione (PubChem CID 2997082) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-fluorophenyl)-3-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2997082 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(1-pyrimidin-2-ylpiperidin-4-yl)amino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NC2CCN(c3ncccn3)CC2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN5O2/c20-13-2-4-15(5-3-13)25-17(26)12-16(18(25)27)23-14-6-10-24(11-7-14)19-21-8-1-9-22-19/h1-5,8-9,14,16,23H,6-7,10-12H2 |
| InChIKey | KJMMVXZTXUOYLF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|