C18H17N3O3 — CID 2997550
2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-phenylacetamide (PubChem CID 2997550) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-phenylacetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 2997550 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)NC(Cc2ccccc2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H17N3O3/c22-16(19-14-9-5-2-6-10-14)12-21-17(23)15(20-18(21)24)11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,19,22)(H,20,24) |
| InChIKey | JGDVEASUBBNKOX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|