C21H23N5O3S2 — CID 2997557
2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone (PubChem CID 2997557) has the molecular formula C21H23N5O3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 2997557 |
| Molecular Formula | C21H23N5O3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone |
| SMILES | Nn1cc(-c2ccccc2)nc1SCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N5O3S2/c22-26-15-19(17-7-3-1-4-8-17)23-21(26)30-16-20(27)24-11-13-25(14-12-24)31(28,29)18-9-5-2-6-10-18/h1-10,15H,11-14,16,22H2 |
| InChIKey | JUKUWDSVUMLFLK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |