C24H28N2O7 — CID 2997730
diethyl 5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 2997730) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is diethyl 5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2997730 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | diethyl 5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(COC(=O)C2CC(=O)N(Cc3ccccc3)C2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C24H28N2O7/c1-4-31-23(29)20-15(3)21(24(30)32-5-2)25-18(20)14-33-22(28)17-11-19(27)26(13-17)12-16-9-7-6-8-10-16/h6-10,17,25H,4-5,11-14H2,1-3H3 |
| InChIKey | HKMRCMJMNAXBRM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|