C19H24N4O4 — CID 2997886
2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-(cyclohexylcarbamoyl)acetamide (PubChem CID 2997886) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-(cyclohexylcarbamoyl)acetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-(cyclohexylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2997886 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-(cyclohexylcarbamoyl)acetamide |
| SMILES | O=C(CN1C(=O)NC(Cc2ccccc2)C1=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H24N4O4/c24-16(22-18(26)20-14-9-5-2-6-10-14)12-23-17(25)15(21-19(23)27)11-13-7-3-1-4-8-13/h1,3-4,7-8,14-15H,2,5-6,9-12H2,(H,21,27)(H2,20,22,24,26) |
| InChIKey | FOIOGYRLHQJSCB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|