C13H11ClN4OS — CID 2999620
1-(4-chlorophenyl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)urea (PubChem CID 2999620) has the molecular formula C13H11ClN4OS and a molecular weight of 306.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)urea |
|---|---|
| PubChem CID | 2999620 |
| Molecular Formula | C13H11ClN4OS |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)urea |
| SMILES | O=C(NCc1cn2ccsc2n1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClN4OS/c14-9-1-3-10(4-2-9)16-12(19)15-7-11-8-18-5-6-20-13(18)17-11/h1-6,8H,7H2,(H2,15,16,19) |
| InChIKey | ZOQZJUQUUBPPFF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |