About 3-methoxyaniline
3-methoxyaniline (PubChem CID 10824) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 3-methoxyaniline.
Molecular Properties
| Compound Name | 3-methoxyaniline |
| PubChem CID | 10824 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 3-methoxyaniline |
| SMILES | COc1cccc(N)c1 |
| InChI | InChI=1S/C7H9NO/c1-9-7-4-2-3-6(8)5-7/h2-5H,8H2,1H3 |
| InChIKey | NCBZRJODKRCREW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyaniline?
The IUPAC name of 3-methoxyaniline (CID 10824) is 3-methoxyaniline.
What is the SMILES notation for 3-methoxyaniline?
The canonical SMILES for 3-methoxyaniline is COc1cccc(N)c1.
What is the InChIKey of 3-methoxyaniline?
The InChIKey is NCBZRJODKRCREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-9-7-4-2-3-6(8)5-7/h2-5H,8H2,1H3.
What are the key properties of 3-methoxyaniline?
3-methoxyaniline has a molecular weight of 123.15 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyaniline is sourced from PubChem (CID 10824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).