About 3-methylheptane
3-methylheptane (PubChem CID 11519) has the molecular formula C8H18
and a molecular weight of 114.23 g/mol. Its IUPAC name is 3-methylheptane.
Molecular Properties
| Compound Name | 3-methylheptane |
| PubChem CID | 11519 |
| Molecular Formula | C8H18 |
| Molecular Weight | 114.23 g/mol |
| Exact Mass | 114.14 |
| IUPAC Name | 3-methylheptane |
| SMILES | CCCCC(C)CC |
| InChI | InChI=1S/C8H18/c1-4-6-7-8(3)5-2/h8H,4-7H2,1-3H3 |
| InChIKey | LAIUFBWHERIJIH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptane?
The IUPAC name of 3-methylheptane (CID 11519) is 3-methylheptane.
What is the SMILES notation for 3-methylheptane?
The canonical SMILES for 3-methylheptane is CCCCC(C)CC.
What is the InChIKey of 3-methylheptane?
The InChIKey is LAIUFBWHERIJIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18/c1-4-6-7-8(3)5-2/h8H,4-7H2,1-3H3.
What are the key properties of 3-methylheptane?
3-methylheptane has a molecular weight of 114.23 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptane is sourced from PubChem (CID 11519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).