About 3-propoxybenzamide
3-propoxybenzamide (PubChem CID 22311435) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-propoxybenzamide.
Molecular Properties
| Compound Name | 3-propoxybenzamide |
| PubChem CID | 22311435 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C10H13NO2/c1-2-6-13-9-5-3-4-8(7-9)10(11)12/h3-5,7H,2,6H2,1H3,(H2,11,12) |
| InChIKey | CGBSBLJPTFJTLZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxybenzamide?
The IUPAC name of 3-propoxybenzamide (CID 22311435) is 3-propoxybenzamide.
What is the SMILES notation for 3-propoxybenzamide?
The canonical SMILES for 3-propoxybenzamide is CCCOc1cccc(C(N)=O)c1.
What is the InChIKey of 3-propoxybenzamide?
The InChIKey is CGBSBLJPTFJTLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-6-13-9-5-3-4-8(7-9)10(11)12/h3-5,7H,2,6H2,1H3,(H2,11,12).
What are the key properties of 3-propoxybenzamide?
3-propoxybenzamide has a molecular weight of 179.22 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxybenzamide is sourced from PubChem (CID 22311435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).