C20H16FN3O2S — CID 30001434
2-[3-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione (PubChem CID 30001434) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[3-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 30001434 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[3-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCSc1nccn1-c1cccc(F)c1 |
| InChI | InChI=1S/C20H16FN3O2S/c21-14-5-3-6-15(13-14)23-11-9-22-20(23)27-12-4-10-24-18(25)16-7-1-2-8-17(16)19(24)26/h1-3,5-9,11,13H,4,10,12H2 |
| InChIKey | AKLHBPNBVQUJHR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|