C21H19N3O3S — CID 46675691
2-[3-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione (PubChem CID 46675691) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[3-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46675691 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[3-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-n2ccnc2SCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-27-16-9-7-15(8-10-16)23-13-11-22-21(23)28-14-4-12-24-19(25)17-5-2-3-6-18(17)20(24)26/h2-3,5-11,13H,4,12,14H2,1H3 |
| InChIKey | PJMLLDHJWQDPPQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|