About methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate
methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate (PubChem CID 30031209) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate |
| PubChem CID | 30031209 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate |
| SMILES | CC[C@@](C)(C(=O)OC)N1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H23NO3/c1-6-12(4,11(14)15-5)13-7-9(2)16-10(3)8-13/h9-10H,6-8H2,1-5H3/t9-,10-,12-/m0/s1 |
| InChIKey | IUOXSJDTMHVUNH-NHCYSSNCSA-N |
| XLogP | 1.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate?
The IUPAC name of methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate (CID 30031209) is methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate.
What is the SMILES notation for methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate?
The canonical SMILES for methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate is CC[C@@](C)(C(=O)OC)N1C[C@H](C)O[C@@H](C)C1.
What is the InChIKey of methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate?
The InChIKey is IUOXSJDTMHVUNH-NHCYSSNCSA-N. The full InChI is InChI=1S/C12H23NO3/c1-6-12(4,11(14)15-5)13-7-9(2)16-10(3)8-13/h9-10H,6-8H2,1-5H3/t9-,10-,12-/m0/s1.
What are the key properties of methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate?
methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate has a molecular weight of 229.32 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoate is sourced from PubChem (CID 30031209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).