C13H10Cl2O3S — CID 30032121
5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbaldehyde (PubChem CID 30032121) has the molecular formula C13H10Cl2O3S and a molecular weight of 317.19 g/mol. Its IUPAC name is 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 30032121 |
| Molecular Formula | C13H10Cl2O3S |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(SCCO)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C13H10Cl2O3S/c14-12-9(10-3-1-8(7-17)18-10)2-4-11(13(12)15)19-6-5-16/h1-4,7,16H,5-6H2 |
| InChIKey | TWOFEXAKJCJFIC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|