C13H21N5O2S — CID 3003818
6-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one (PubChem CID 3003818) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 6-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3003818 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 6-(3-morpholin-4-ylpropyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(CCCN1CCOCC1)CN2 |
| InChI | InChI=1S/C13H21N5O2S/c19-12-10-8-18(9-14-11(10)15-13(21)16-12)3-1-2-17-4-6-20-7-5-17/h1-9H2,(H3,14,15,16,19,21) |
| InChIKey | SVINEZKIGWLMLB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|