C4H6N2S2 — CID 3004056
piperazine-2,5-dithione (PubChem CID 3004056) has the molecular formula C4H6N2S2 and a molecular weight of 146.24 g/mol. Its IUPAC name is piperazine-2,5-dithione.
| Compound Name | piperazine-2,5-dithione |
|---|---|
| PubChem CID | 3004056 |
| Molecular Formula | C4H6N2S2 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | piperazine-2,5-dithione |
| SMILES | S=C1CNC(=S)CN1 |
| InChI | InChI=1S/C4H6N2S2/c7-3-1-5-4(8)2-6-3/h1-2H2,(H,5,8)(H,6,7) |
| InChIKey | WZZNXLLUTNONRL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|