C8H11N5O2S — CID 3004226
2-amino-7-(2,3-dihydroxypropyl)-3H-purine-6-thione (PubChem CID 3004226) has the molecular formula C8H11N5O2S and a molecular weight of 241.28 g/mol. Its IUPAC name is 2-amino-7-(2,3-dihydroxypropyl)-3H-purine-6-thione.
| Compound Name | 2-amino-7-(2,3-dihydroxypropyl)-3H-purine-6-thione |
|---|---|
| PubChem CID | 3004226 |
| Molecular Formula | C8H11N5O2S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-amino-7-(2,3-dihydroxypropyl)-3H-purine-6-thione |
| SMILES | Nc1nc(=S)c2c(ncn2CC(O)CO)[nH]1 |
| InChI | InChI=1S/C8H11N5O2S/c9-8-11-6-5(7(16)12-8)13(3-10-6)1-4(15)2-14/h3-4,14-15H,1-2H2,(H3,9,11,12,16) |
| InChIKey | XVEXUEUWZLTZCH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|