C8H11ClN4O2S — CID 3054007
9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride (PubChem CID 3054007) has the molecular formula C8H11ClN4O2S and a molecular weight of 262.72 g/mol. Its IUPAC name is 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride.
| Compound Name | 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride |
|---|---|
| PubChem CID | 3054007 |
| Molecular Formula | C8H11ClN4O2S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride |
| SMILES | Cl.OCC(CO)n1cnc2c(=S)nc[nH]c21 |
| InChI | InChI=1S/C8H10N4O2S.ClH/c13-1-5(2-14)12-4-11-6-7(12)9-3-10-8(6)15;/h3-5,13-14H,1-2H2,(H,9,10,15);1H |
| InChIKey | YCNJCXRHOINSIV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|