About 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride
9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride (PubChem CID 3054007) has the molecular formula C8H11ClN4O2S
and a molecular weight of 262.72 g/mol. Its IUPAC name is 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride.
Molecular Properties
| Compound Name | 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride |
| PubChem CID | 3054007 |
| Molecular Formula | C8H11ClN4O2S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride |
| SMILES | Cl.OCC(CO)n1cnc2c(=S)nc[nH]c21 |
| InChI | InChI=1S/C8H10N4O2S.ClH/c13-1-5(2-14)12-4-11-6-7(12)9-3-10-8(6)15;/h3-5,13-14H,1-2H2,(H,9,10,15);1H |
| InChIKey | YCNJCXRHOINSIV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride?
The IUPAC name of 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride (CID 3054007) is 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride.
What is the SMILES notation for 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride?
The canonical SMILES for 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride is Cl.OCC(CO)n1cnc2c(=S)nc[nH]c21.
What is the InChIKey of 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride?
The InChIKey is YCNJCXRHOINSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S.ClH/c13-1-5(2-14)12-4-11-6-7(12)9-3-10-8(6)15;/h3-5,13-14H,1-2H2,(H,9,10,15);1H.
What are the key properties of 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride?
9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride has a molecular weight of 262.72 g/mol, XLogP of 0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,3-dihydroxypropan-2-yl)-3H-purine-6-thione;hydrochloride is sourced from PubChem (CID 3054007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).