C12H11N5 — CID 3005069
N-[(E)-2-amino-1,2-dicyanoethenyl]-N'-benzylmethanimidamide (PubChem CID 3005069) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-[(E)-2-amino-1,2-dicyanoethenyl]-N'-benzylmethanimidamide.
| Compound Name | N-[(E)-2-amino-1,2-dicyanoethenyl]-N'-benzylmethanimidamide |
|---|---|
| PubChem CID | 3005069 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-[(E)-2-amino-1,2-dicyanoethenyl]-N'-benzylmethanimidamide |
| SMILES | N#C/C(N)=C(/C#N)N/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C12H11N5/c13-6-11(15)12(7-14)17-9-16-8-10-4-2-1-3-5-10/h1-5,9H,8,15H2,(H,16,17)/b12-11+ |
| InChIKey | UQZZHPMRAWQUAV-VAWYXSNFSA-N |
| XLogP | 1.02 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|