C13H15N3O2S — CID 3006143
4,6,6-trimethyl-3-(4-nitrophenyl)-1H-pyrimidine-2-thione (PubChem CID 3006143) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4,6,6-trimethyl-3-(4-nitrophenyl)-1H-pyrimidine-2-thione.
| Compound Name | 4,6,6-trimethyl-3-(4-nitrophenyl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 3006143 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4,6,6-trimethyl-3-(4-nitrophenyl)-1H-pyrimidine-2-thione |
| SMILES | CC1=CC(C)(C)NC(=S)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15N3O2S/c1-9-8-13(2,3)14-12(19)15(9)10-4-6-11(7-5-10)16(17)18/h4-8H,1-3H3,(H,14,19) |
| InChIKey | CPIHDWICCAVJDB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|