C14H8Cl5NO4S — CID 3006810
(2,3,4,5,6-pentachlorophenyl) N-(4-methylsulfonylphenyl)carbamate (PubChem CID 3006810) has the molecular formula C14H8Cl5NO4S and a molecular weight of 463.55 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) N-(4-methylsulfonylphenyl)carbamate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) N-(4-methylsulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 3006810 |
| Molecular Formula | C14H8Cl5NO4S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 460.86 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) N-(4-methylsulfonylphenyl)carbamate |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C14H8Cl5NO4S/c1-25(22,23)7-4-2-6(3-5-7)20-14(21)24-13-11(18)9(16)8(15)10(17)12(13)19/h2-5H,1H3,(H,20,21) |
| InChIKey | RESPGVFSGXNGGW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|