C19H20N6O6S2 — CID 30096126
2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 30096126) has the molecular formula C19H20N6O6S2 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30096126 |
| Molecular Formula | C19H20N6O6S2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CSc1nncn1Cc1ccco1)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H20N6O6S2/c26-18(13-32-19-21-20-14-23(19)12-16-4-2-10-31-16)22-6-8-24(9-7-22)33(29,30)17-5-1-3-15(11-17)25(27)28/h1-5,10-11,14H,6-9,12-13H2 |
| InChIKey | SXAONEZDRMSARN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 144.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|