C14H25N — CID 3010119
N,N-diethyladamantan-1-amine (PubChem CID 3010119) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N,N-diethyladamantan-1-amine.
| Compound Name | N,N-diethyladamantan-1-amine |
|---|---|
| PubChem CID | 3010119 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N,N-diethyladamantan-1-amine |
| SMILES | CCN(CC)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H25N/c1-3-15(4-2)14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13H,3-10H2,1-2H3 |
| InChIKey | GJOSMKOKKDLWKH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |