C9H10N4O2S2 — CID 3010784
2-[5-(methylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide (PubChem CID 3010784) has the molecular formula C9H10N4O2S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-[5-(methylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide.
| Compound Name | 2-[5-(methylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3010784 |
| Molecular Formula | C9H10N4O2S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-[5-(methylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| SMILES | CNc1nnc(-c2ccccc2S(N)(=O)=O)s1 |
| InChI | InChI=1S/C9H10N4O2S2/c1-11-9-13-12-8(16-9)6-4-2-3-5-7(6)17(10,14)15/h2-5H,1H3,(H,11,13)(H2,10,14,15) |
| InChIKey | ZBEAXIPDBQJYRX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |