C10H12N4O2S2 — CID 3010786
2-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide (PubChem CID 3010786) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide.
| Compound Name | 2-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3010786 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| SMILES | CCNc1nnc(-c2ccccc2S(N)(=O)=O)s1 |
| InChI | InChI=1S/C10H12N4O2S2/c1-2-12-10-14-13-9(17-10)7-5-3-4-6-8(7)18(11,15)16/h3-6H,2H2,1H3,(H,12,14)(H2,11,15,16) |
| InChIKey | NRMCPOXVTWWEBL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |