C11H12N4O2S2 — CID 3010785
2-[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide (PubChem CID 3010785) has the molecular formula C11H12N4O2S2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide.
| Compound Name | 2-[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3010785 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| SMILES | C=CCNc1nnc(-c2ccccc2S(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H12N4O2S2/c1-2-7-13-11-15-14-10(18-11)8-5-3-4-6-9(8)19(12,16)17/h2-6H,1,7H2,(H,13,15)(H2,12,16,17) |
| InChIKey | GJPZRXDSBOIBRB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|