C20H14O9 — CID 3010881
(13R)-7,13,15,15-tetrahydroxy-3,11,21,22-tetraoxaheptacyclo[10.9.1.11,6.112,16.02,4.010,24.020,23]tetracosa-6,8,10(24),16(23),17,19-hexaen-5-one (PubChem CID 3010881) has the molecular formula C20H14O9 and a molecular weight of 398.32 g/mol. Its IUPAC name is (13R)-7,13,15,15-tetrahydroxy-3,11,21,22-tetraoxaheptacyclo[10.9.1.11,6.112,16.02,4.010,24.020,23]tetracosa-6,8,10(24),16(23),17,19-hexaen-5-one.
| Compound Name | (13R)-7,13,15,15-tetrahydroxy-3,11,21,22-tetraoxaheptacyclo[10.9.1.11,6.112,16.02,4.010,24.020,23]tetracosa-6,8,10(24),16(23),17,19-hexaen-5-one |
|---|---|
| PubChem CID | 3010881 |
| Molecular Formula | C20H14O9 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | (13R)-7,13,15,15-tetrahydroxy-3,11,21,22-tetraoxaheptacyclo[10.9.1.11,6.112,16.02,4.010,24.020,23]tetracosa-6,8,10(24),16(23),17,19-hexaen-5-one |
| SMILES | O=C1c2c(O)ccc3c2C2(Oc4cccc5c4C(O3)(O2)[C@H](O)CC5(O)O)C2OC12 |
| InChI | InChI=1S/C20H14O9/c21-8-4-5-10-14-12(8)15(23)16-17(26-16)20(14)28-9-3-1-2-7-13(9)19(27-10,29-20)11(22)6-18(7,24)25/h1-5,11,16-17,21-22,24-25H,6H2/t11-,16?,17?,19?,20?/m1/s1 |
| InChIKey | SLLAWRQEFYZPNX-RCEPNBATSA-N |
| XLogP | 0.07 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|