C20H8Cl2O8 — CID 162889286
(1S,2R,12S,13R)-8,19-dichloro-7,18-dihydroxy-3,11,14,22-tetraoxaoctacyclo[10.9.1.11,6.112,17.02,4.013,15.010,24.021,23]tetracosa-6(24),7,9,17(23),18,20-hexaene-5,16-dione (PubChem CID 162889286) has the molecular formula C20H8Cl2O8 and a molecular weight of 447.18 g/mol. Its IUPAC name is (1S,2R,12S,13R)-8,19-dichloro-7,18-dihydroxy-3,11,14,22-tetraoxaoctacyclo[10.9.1.11,6.112,17.02,4.013,15.010,24.021,23]tetracosa-6(24),7,9,17(23),18,20-hexaene-5,16-dione.
| Compound Name | (1S,2R,12S,13R)-8,19-dichloro-7,18-dihydroxy-3,11,14,22-tetraoxaoctacyclo[10.9.1.11,6.112,17.02,4.013,15.010,24.021,23]tetracosa-6(24),7,9,17(23),18,20-hexaene-5,16-dione |
|---|---|
| PubChem CID | 162889286 |
| Molecular Formula | C20H8Cl2O8 |
| Molecular Weight | 447.18 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | (1S,2R,12S,13R)-8,19-dichloro-7,18-dihydroxy-3,11,14,22-tetraoxaoctacyclo[10.9.1.11,6.112,17.02,4.013,15.010,24.021,23]tetracosa-6(24),7,9,17(23),18,20-hexaene-5,16-dione |
| SMILES | O=C1c2c(O)c(Cl)cc3c2[C@@]2(Oc4cc(Cl)c(O)c5c4[C@]3(O2)[C@@H]2OC2C5=O)[C@@H]2OC12 |
| InChI | InChI=1S/C20H8Cl2O8/c21-4-1-3-9-7(11(4)23)13(25)16-18(28-16)20(9)29-6-2-5(22)12(24)8-10(6)19(3,30-20)17-15(27-17)14(8)26/h1-2,15-18,23-24H/t15?,16?,17-,18-,19+,20+/m1/s1 |
| InChIKey | NJXOYNMFAXWFQF-DFQMEVPNSA-N |
| XLogP | 2.15 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|