C15H10ClNO3 — CID 156895678
(4bS)-1-amino-7-chloro-4b-hydroxy-9bH-indeno[1,2-b][1]benzofuran-10-one (PubChem CID 156895678) has the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. Its IUPAC name is (4bS)-1-amino-7-chloro-4b-hydroxy-9bH-indeno[1,2-b][1]benzofuran-10-one.
| Compound Name | (4bS)-1-amino-7-chloro-4b-hydroxy-9bH-indeno[1,2-b][1]benzofuran-10-one |
|---|---|
| PubChem CID | 156895678 |
| Molecular Formula | C15H10ClNO3 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (4bS)-1-amino-7-chloro-4b-hydroxy-9bH-indeno[1,2-b][1]benzofuran-10-one |
| SMILES | Nc1cccc2c1C(=O)C1c3ccc(Cl)cc3O[C@]21O |
| InChI | InChI=1S/C15H10ClNO3/c16-7-4-5-8-11(6-7)20-15(19)9-2-1-3-10(17)12(9)14(18)13(8)15/h1-6,13,19H,17H2/t13?,15-/m1/s1 |
| InChIKey | OBYYWJDCCWEFFM-AWKYBWMHSA-N |
| XLogP | 2.44 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|