C15H7Cl2NO5 — CID 156895674
7,9b-dichloro-4b-hydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one (PubChem CID 156895674) has the molecular formula C15H7Cl2NO5 and a molecular weight of 352.13 g/mol. Its IUPAC name is 7,9b-dichloro-4b-hydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one.
| Compound Name | 7,9b-dichloro-4b-hydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one |
|---|---|
| PubChem CID | 156895674 |
| Molecular Formula | C15H7Cl2NO5 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 7,9b-dichloro-4b-hydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C2(O)Oc3cc(Cl)ccc3C12Cl |
| InChI | InChI=1S/C15H7Cl2NO5/c16-7-4-5-9-11(6-7)23-15(20)12-8(13(19)14(9,15)17)2-1-3-10(12)18(21)22/h1-6,20H |
| InChIKey | KPKQMBIVDPBDHJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|