C29H22N2O6 — CID 86716918
N-(4b-hydroxy-4-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)naphthalene-2-carboxamide (PubChem CID 86716918) has the molecular formula C29H22N2O6 and a molecular weight of 494.50 g/mol. Its IUPAC name is N-(4b-hydroxy-4-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)naphthalene-2-carboxamide.
| Compound Name | N-(4b-hydroxy-4-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 86716918 |
| Molecular Formula | C29H22N2O6 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-(4b-hydroxy-4-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)naphthalene-2-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3c(cccc3[N+](=O)[O-])C(=O)C21NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H22N2O6/c1-16(2)18-12-13-22-24(15-18)37-29(34)25-21(8-5-9-23(25)31(35)36)26(32)28(22,29)30-27(33)20-11-10-17-6-3-4-7-19(17)14-20/h3-16,34H,1-2H3,(H,30,33) |
| InChIKey | GEMSEZGEUTZNHR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|