C23H19N3O7 — CID 86716982
5-amino-N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)furan-2-carboxamide (PubChem CID 86716982) has the molecular formula C23H19N3O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is 5-amino-N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 86716982 |
| Molecular Formula | C23H19N3O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-amino-N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)furan-2-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc([N+](=O)[O-])c3C(=O)C21NC(=O)c1ccc(N)o1 |
| InChI | InChI=1S/C23H19N3O7/c1-11(2)12-6-7-13-17(10-12)33-23(29)14-4-3-5-15(26(30)31)19(14)20(27)22(13,23)25-21(28)16-8-9-18(24)32-16/h3-11,29H,24H2,1-2H3,(H,25,28) |
| InChIKey | CNZXUFJRYMVNMN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 157.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|