C20H15F3N2O6 — CID 86716923
N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide (PubChem CID 86716923) has the molecular formula C20H15F3N2O6 and a molecular weight of 436.34 g/mol. Its IUPAC name is N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86716923 |
| Molecular Formula | C20H15F3N2O6 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc([N+](=O)[O-])c3C(=O)C21NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H15F3N2O6/c1-9(2)10-6-7-11-14(8-10)31-19(28)12-4-3-5-13(25(29)30)15(12)16(26)18(11,19)24-17(27)20(21,22)23/h3-9,28H,1-2H3,(H,24,27) |
| InChIKey | SZBGQCUOJSPBRI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|