C18H11F3N2O6 — CID 156895673
N-[4b-hydroxy-4-nitro-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide (PubChem CID 156895673) has the molecular formula C18H11F3N2O6 and a molecular weight of 408.29 g/mol. Its IUPAC name is N-[4b-hydroxy-4-nitro-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide.
| Compound Name | N-[4b-hydroxy-4-nitro-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide |
|---|---|
| PubChem CID | 156895673 |
| Molecular Formula | C18H11F3N2O6 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-[4b-hydroxy-4-nitro-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide |
| SMILES | CC(=O)NC12C(=O)c3cccc([N+](=O)[O-])c3C1(O)Oc1cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C18H11F3N2O6/c1-8(24)22-16-11-6-5-9(18(19,20)21)7-13(11)29-17(16,26)14-10(15(16)25)3-2-4-12(14)23(27)28/h2-7,26H,1H3,(H,22,24) |
| InChIKey | OZLBDNCVMLWKGR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|