C18H13NO6 — CID 156895626
7-cyclopropyl-4b,9b-dihydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one (PubChem CID 156895626) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is 7-cyclopropyl-4b,9b-dihydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one.
| Compound Name | 7-cyclopropyl-4b,9b-dihydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one |
|---|---|
| PubChem CID | 156895626 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 7-cyclopropyl-4b,9b-dihydroxy-4-nitroindeno[1,2-b][1]benzofuran-10-one |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C2(O)Oc3cc(C4CC4)ccc3C12O |
| InChI | InChI=1S/C18H13NO6/c20-16-11-2-1-3-13(19(23)24)15(11)18(22)17(16,21)12-7-6-10(9-4-5-9)8-14(12)25-18/h1-3,6-9,21-22H,4-5H2 |
| InChIKey | YRGADIOTARQAIY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|