C25H23Cl6N3O9 — CID 158963622
1-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-propan-2-ylurea;bis(trichloromethyl) carbonate (PubChem CID 158963622) has the molecular formula C25H23Cl6N3O9 and a molecular weight of 722.19 g/mol. Its IUPAC name is 1-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-propan-2-ylurea;bis(trichloromethyl) carbonate.
| Compound Name | 1-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-propan-2-ylurea;bis(trichloromethyl) carbonate |
|---|---|
| PubChem CID | 158963622 |
| Molecular Formula | C25H23Cl6N3O9 |
| Molecular Weight | 722.19 g/mol |
| Exact Mass | 718.96 |
| IUPAC Name | 1-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-propan-2-ylurea;bis(trichloromethyl) carbonate |
| SMILES | CC(C)NC(=O)NC12C(=O)c3c([N+](=O)[O-])cccc3C1(O)Oc1cc(C(C)C)ccc12.O=C(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H23N3O6.C3Cl6O3/c1-11(2)13-8-9-14-17(10-13)31-22(28)15-6-5-7-16(25(29)30)18(15)19(26)21(14,22)24-20(27)23-12(3)4;4-2(5,6)11-1(10)12-3(7,8)9/h5-12,28H,1-4H3,(H2,23,24,27); |
| InChIKey | JMXQQXUZGRVDTQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.19 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|