C32H24N2O7 — CID 86716990
N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-9H-xanthene-9-carboxamide (PubChem CID 86716990) has the molecular formula C32H24N2O7 and a molecular weight of 548.55 g/mol. Its IUPAC name is N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-9H-xanthene-9-carboxamide.
| Compound Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 86716990 |
| Molecular Formula | C32H24N2O7 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-9H-xanthene-9-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc([N+](=O)[O-])c3C(=O)C21NC(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C32H24N2O7/c1-17(2)18-14-15-21-26(16-18)41-32(37)22-10-7-11-23(34(38)39)28(22)29(35)31(21,32)33-30(36)27-19-8-3-5-12-24(19)40-25-13-6-4-9-20(25)27/h3-17,27,37H,1-2H3,(H,33,36) |
| InChIKey | DUBRQOSXNADYIS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|