C26H23FN2O4 — CID 153253236
N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-(4-fluorophenyl)acetamide (PubChem CID 153253236) has the molecular formula C26H23FN2O4 and a molecular weight of 446.48 g/mol. Its IUPAC name is N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 153253236 |
| Molecular Formula | C26H23FN2O4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-(4-fluorophenyl)acetamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H23FN2O4/c1-14(2)16-8-11-18-21(13-16)33-26(32)19-4-3-5-20(28)23(19)24(31)25(18,26)29-22(30)12-15-6-9-17(27)10-7-15/h3-11,13-14,32H,12,28H2,1-2H3,(H,29,30) |
| InChIKey | WTTIZQPUTXJESX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|