C27H18ClFN2O6S — CID 90097713
N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 90097713) has the molecular formula C27H18ClFN2O6S and a molecular weight of 552.97 g/mol. Its IUPAC name is N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 90097713 |
| Molecular Formula | C27H18ClFN2O6S |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | N-(4b-hydroxy-1-nitro-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc([N+](=O)[O-])c3C(=O)C21NC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C27H18ClFN2O6S/c1-12(2)13-6-9-16-19(10-13)37-27(34)17-4-3-5-18(31(35)36)21(17)24(32)26(16,27)30-25(33)23-22(28)15-8-7-14(29)11-20(15)38-23/h3-12,34H,1-2H3,(H,30,33) |
| InChIKey | NRRXTDQVSJCDNX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|