C18H17NO3 — CID 154205419
1-amino-9b-hydroxy-7-propan-2-yl-4bH-indeno[1,2-b][1]benzofuran-10-one (PubChem CID 154205419) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-amino-9b-hydroxy-7-propan-2-yl-4bH-indeno[1,2-b][1]benzofuran-10-one.
| Compound Name | 1-amino-9b-hydroxy-7-propan-2-yl-4bH-indeno[1,2-b][1]benzofuran-10-one |
|---|---|
| PubChem CID | 154205419 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-amino-9b-hydroxy-7-propan-2-yl-4bH-indeno[1,2-b][1]benzofuran-10-one |
| SMILES | CC(C)c1ccc2c(c1)OC1c3cccc(N)c3C(=O)C21O |
| InChI | InChI=1S/C18H17NO3/c1-9(2)10-6-7-12-14(8-10)22-17-11-4-3-5-13(19)15(11)16(20)18(12,17)21/h3-9,17,21H,19H2,1-2H3 |
| InChIKey | UXUIZABOSAJDKU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|