C20H27N3O2S — CID 30136380
2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 30136380) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 30136380 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)CN3C[C@@H](C)O[C@H](C)C3)n2)cc1C |
| InChI | InChI=1S/C20H27N3O2S/c1-12-6-14(3)17(7-13(12)2)18-11-26-20(21-18)22-19(24)10-23-8-15(4)25-16(5)9-23/h6-7,11,15-16H,8-10H2,1-5H3,(H,21,22,24)/t15-,16-/m1/s1 |
| InChIKey | MNTGVMMABXKRLB-HZPDHXFCSA-N |
| XLogP | 3.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |